C14H20N2 — CID 102626126
2-hexyl-5-methylimidazo[1,2-a]pyridine (PubChem CID 102626126) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-hexyl-5-methylimidazo[1,2-a]pyridine.
| Compound Name | 2-hexyl-5-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 102626126 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-hexyl-5-methylimidazo[1,2-a]pyridine |
| SMILES | CCCCCCc1cn2c(C)cccc2n1 |
| InChI | InChI=1S/C14H20N2/c1-3-4-5-6-9-13-11-16-12(2)8-7-10-14(16)15-13/h7-8,10-11H,3-6,9H2,1-2H3 |
| InChIKey | WIDXAPMVBCABAO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|