C13H24N2 — CID 118062821
1,2-dimethyl-4-octylimidazole (PubChem CID 118062821) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1,2-dimethyl-4-octylimidazole.
| Compound Name | 1,2-dimethyl-4-octylimidazole |
|---|---|
| PubChem CID | 118062821 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1,2-dimethyl-4-octylimidazole |
| SMILES | CCCCCCCCc1cn(C)c(C)n1 |
| InChI | InChI=1S/C13H24N2/c1-4-5-6-7-8-9-10-13-11-15(3)12(2)14-13/h11H,4-10H2,1-3H3 |
| InChIKey | WXMJDMCYEFFAKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|