C11H13N3O2 — CID 117133461
7-methoxy-2-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 117133461) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 7-methoxy-2-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-methoxy-2-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117133461 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 7-methoxy-2-(oxolan-3-yl)-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | COc1ccn2nc(C3CCOC3)nc2c1 |
| InChI | InChI=1S/C11H13N3O2/c1-15-9-2-4-14-10(6-9)12-11(13-14)8-3-5-16-7-8/h2,4,6,8H,3,5,7H2,1H3 |
| InChIKey | URKKHUUKSHKSDT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |