C11H9N5 — CID 117134890
2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridin-7-amine (PubChem CID 117134890) has the molecular formula C11H9N5 and a molecular weight of 211.23 g/mol. Its IUPAC name is 2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridin-7-amine.
| Compound Name | 2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117134890 |
| Molecular Formula | C11H9N5 |
| Molecular Weight | 211.23 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 2-pyridin-2-yl-[1,2,4]triazolo[1,5-a]pyridin-7-amine |
| SMILES | Nc1ccn2nc(-c3ccccn3)nc2c1 |
| InChI | InChI=1S/C11H9N5/c12-8-4-6-16-10(7-8)14-11(15-16)9-3-1-2-5-13-9/h1-7H,12H2 |
| InChIKey | GFSJEMIJLNCANU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |