C29H26F2N4O4 — CID 11713503
methyl 2-fluoro-6-[3-fluoro-4-[[[4-(3-imidazol-1-ylpropylcarbamoyl)benzoyl]amino]methyl]phenyl]benzoate (PubChem CID 11713503) has the molecular formula C29H26F2N4O4 and a molecular weight of 532.55 g/mol. Its IUPAC name is methyl 2-fluoro-6-[3-fluoro-4-[[[4-(3-imidazol-1-ylpropylcarbamoyl)benzoyl]amino]methyl]phenyl]benzoate.
| Compound Name | methyl 2-fluoro-6-[3-fluoro-4-[[[4-(3-imidazol-1-ylpropylcarbamoyl)benzoyl]amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 11713503 |
| Molecular Formula | C29H26F2N4O4 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | methyl 2-fluoro-6-[3-fluoro-4-[[[4-(3-imidazol-1-ylpropylcarbamoyl)benzoyl]amino]methyl]phenyl]benzoate |
| SMILES | COC(=O)c1c(F)cccc1-c1ccc(CNC(=O)c2ccc(C(=O)NCCCn3ccnc3)cc2)c(F)c1 |
| InChI | InChI=1S/C29H26F2N4O4/c1-39-29(38)26-23(4-2-5-24(26)30)21-10-11-22(25(31)16-21)17-34-28(37)20-8-6-19(7-9-20)27(36)33-12-3-14-35-15-13-32-18-35/h2,4-11,13,15-16,18H,3,12,14,17H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | YISSEEDNJYAEFG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|