C13H17N3O2 — CID 117138014
6-methoxy-3-(oxan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117138014) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 6-methoxy-3-(oxan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-methoxy-3-(oxan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117138014 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 6-methoxy-3-(oxan-3-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1ccc2nnc(CC3CCCOC3)n2c1 |
| InChI | InChI=1S/C13H17N3O2/c1-17-11-4-5-12-14-15-13(16(12)8-11)7-10-3-2-6-18-9-10/h4-5,8,10H,2-3,6-7,9H2,1H3 |
| InChIKey | JSLRUZVHXYKPSL-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |