C12H15N3O2 — CID 117137949
6-methoxy-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117137949) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 6-methoxy-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 6-methoxy-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117137949 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 6-methoxy-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1ccc2nnc(C3CCCOC3)n2c1 |
| InChI | InChI=1S/C12H15N3O2/c1-16-10-4-5-11-13-14-12(15(11)7-10)9-3-2-6-17-8-9/h4-5,7,9H,2-3,6,8H2,1H3 |
| InChIKey | UOHMMGUFUGBIQS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |