C11H12ClN3O — CID 117146433
8-chloro-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117146433) has the molecular formula C11H12ClN3O and a molecular weight of 237.69 g/mol. Its IUPAC name is 8-chloro-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 8-chloro-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117146433 |
| Molecular Formula | C11H12ClN3O |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 8-chloro-3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Clc1cccn2c(C3CCCOC3)nnc12 |
| InChI | InChI=1S/C11H12ClN3O/c12-9-4-1-5-15-10(13-14-11(9)15)8-3-2-6-16-7-8/h1,4-5,8H,2-3,6-7H2 |
| InChIKey | QFIFODDTIKGHPB-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |