C13H17N3O — CID 117145705
[3-(oxan-3-yl)imidazo[1,5-a]pyridin-8-yl]methanamine (PubChem CID 117145705) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is [3-(oxan-3-yl)imidazo[1,5-a]pyridin-8-yl]methanamine.
| Compound Name | [3-(oxan-3-yl)imidazo[1,5-a]pyridin-8-yl]methanamine |
|---|---|
| PubChem CID | 117145705 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | [3-(oxan-3-yl)imidazo[1,5-a]pyridin-8-yl]methanamine |
| SMILES | NCc1cccn2c(C3CCCOC3)ncc12 |
| InChI | InChI=1S/C13H17N3O/c14-7-10-3-1-5-16-12(10)8-15-13(16)11-4-2-6-17-9-11/h1,3,5,8,11H,2,4,6-7,9,14H2 |
| InChIKey | YFOITXYSCUXPIQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |