C12H15N3O — CID 117141464
3-(oxan-3-yl)imidazo[1,5-a]pyridin-5-amine (PubChem CID 117141464) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 3-(oxan-3-yl)imidazo[1,5-a]pyridin-5-amine.
| Compound Name | 3-(oxan-3-yl)imidazo[1,5-a]pyridin-5-amine |
|---|---|
| PubChem CID | 117141464 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 3-(oxan-3-yl)imidazo[1,5-a]pyridin-5-amine |
| SMILES | Nc1cccc2cnc(C3CCCOC3)n12 |
| InChI | InChI=1S/C12H15N3O/c13-11-5-1-4-10-7-14-12(15(10)11)9-3-2-6-16-8-9/h1,4-5,7,9H,2-3,6,8,13H2 |
| InChIKey | ZNJCZNSDHHCQSF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |