C11H13N3O — CID 117138986
3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117138986) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117138986 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(oxan-3-yl)-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | c1ccn2c(C3CCCOC3)nnc2c1 |
| InChI | InChI=1S/C11H13N3O/c1-2-6-14-10(5-1)12-13-11(14)9-4-3-7-15-8-9/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | RTXPOOFTJYOGCY-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |