C13H17N3O2S — CID 117138194
[3-(1,1-dioxothian-4-yl)imidazo[1,5-a]pyridin-6-yl]methanamine (PubChem CID 117138194) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is [3-(1,1-dioxothian-4-yl)imidazo[1,5-a]pyridin-6-yl]methanamine.
| Compound Name | [3-(1,1-dioxothian-4-yl)imidazo[1,5-a]pyridin-6-yl]methanamine |
|---|---|
| PubChem CID | 117138194 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | [3-(1,1-dioxothian-4-yl)imidazo[1,5-a]pyridin-6-yl]methanamine |
| SMILES | NCc1ccc2cnc(C3CCS(=O)(=O)CC3)n2c1 |
| InChI | InChI=1S/C13H17N3O2S/c14-7-10-1-2-12-8-15-13(16(12)9-10)11-3-5-19(17,18)6-4-11/h1-2,8-9,11H,3-7,14H2 |
| InChIKey | NYWOBKZBEFEUKA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |