C12H9N3O2 — CID 117138682
3-(furan-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde (PubChem CID 117138682) has the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde.
| Compound Name | 3-(furan-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
|---|---|
| PubChem CID | 117138682 |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 3-(furan-2-ylmethyl)-[1,2,4]triazolo[4,3-a]pyridine-6-carbaldehyde |
| SMILES | O=Cc1ccc2nnc(Cc3ccco3)n2c1 |
| InChI | InChI=1S/C12H9N3O2/c16-8-9-3-4-11-13-14-12(15(11)7-9)6-10-2-1-5-17-10/h1-5,7-8H,6H2 |
| InChIKey | HSBVBFOEGNIKSN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 60.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|