C8H6FN3O — CID 166537867
2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetaldehyde (PubChem CID 166537867) has the molecular formula C8H6FN3O and a molecular weight of 179.15 g/mol. Its IUPAC name is 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetaldehyde.
| Compound Name | 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 166537867 |
| Molecular Formula | C8H6FN3O |
| Molecular Weight | 179.15 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetaldehyde |
| SMILES | O=CCc1nnc2ccc(F)cn12 |
| InChI | InChI=1S/C8H6FN3O/c9-6-1-2-7-10-11-8(3-4-13)12(7)5-6/h1-2,4-5H,3H2 |
| InChIKey | TUJNUXWVWZWDGK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.15 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|