2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid

C8H6FN3O2 — CID 105448678

IUPAC2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1nnc2ccc(F)cn12
InChIInChI=1S/C8H6FN3O2/c9-5-1-2-6-10-11-7(3-8(13)14)12(6)4-5/h1-2,4H,3H2,(H,13,14)
InChIKeyWDYWEHMYKOEEFQ-UHFFFAOYSA-N
MW195.15 g/mol
LogP0.50
Rot. Bonds2

About 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid

2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid (PubChem CID 105448678) has the molecular formula C8H6FN3O2 and a molecular weight of 195.15 g/mol. Its IUPAC name is 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid
PubChem CID105448678
Molecular FormulaC8H6FN3O2
Molecular Weight195.15 g/mol
Exact Mass195.04
IUPAC Name2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid
SMILESO=C(O)Cc1nnc2ccc(F)cn12
InChIInChI=1S/C8H6FN3O2/c9-5-1-2-6-10-11-7(3-8(13)14)12(6)4-5/h1-2,4H,3H2,(H,13,14)
InChIKeyWDYWEHMYKOEEFQ-UHFFFAOYSA-N
XLogP0.50
TPSA67.49 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500195.15
LogP ≤ 50.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid?
The IUPAC name of 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid (CID 105448678) is 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid.
What is the SMILES notation for 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid?
The canonical SMILES for 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid is O=C(O)Cc1nnc2ccc(F)cn12.
What is the InChIKey of 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid?
The InChIKey is WDYWEHMYKOEEFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FN3O2/c9-5-1-2-6-10-11-7(3-8(13)14)12(6)4-5/h1-2,4H,3H2,(H,13,14).
What are the key properties of 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid?
2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid has a molecular weight of 195.15 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)acetic acid is sourced from PubChem (CID 105448678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).