C10H9FN2O2 — CID 82530345
3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)propanoic acid (PubChem CID 82530345) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)propanoic acid.
| Compound Name | 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)propanoic acid |
|---|---|
| PubChem CID | 82530345 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)propanoic acid |
| SMILES | O=C(O)CCc1cnc2ccc(F)cn12 |
| InChI | InChI=1S/C10H9FN2O2/c11-7-1-3-9-12-5-8(13(9)6-7)2-4-10(14)15/h1,3,5-6H,2,4H2,(H,14,15) |
| InChIKey | WJUASBSJCRNIOJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |