3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid

C10H10N2O2 — CID 62651900

IUPAC3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid
SMILESCCc1cnc2ccc(C(=O)O)cn12
InChIInChI=1S/C10H10N2O2/c1-2-8-5-11-9-4-3-7(10(13)14)6-12(8)9/h3-6H,2H2,1H3,(H,13,14)
InChIKeyXOMIMHCVMFQYTF-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.59
Rot. Bonds2

About 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid

3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid (PubChem CID 62651900) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid.

Molecular Properties

Compound Name3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid
PubChem CID62651900
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Name3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid
SMILESCCc1cnc2ccc(C(=O)O)cn12
InChIInChI=1S/C10H10N2O2/c1-2-8-5-11-9-4-3-7(10(13)14)6-12(8)9/h3-6H,2H2,1H3,(H,13,14)
InChIKeyXOMIMHCVMFQYTF-UHFFFAOYSA-N
XLogP1.59
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.59
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid?
The IUPAC name of 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid (CID 62651900) is 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid.
What is the SMILES notation for 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid?
The canonical SMILES for 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid is CCc1cnc2ccc(C(=O)O)cn12.
What is the InChIKey of 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid?
The InChIKey is XOMIMHCVMFQYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-8-5-11-9-4-3-7(10(13)14)6-12(8)9/h3-6H,2H2,1H3,(H,13,14).
What are the key properties of 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid?
3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid has a molecular weight of 190.20 g/mol, XLogP of 1.59, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylimidazo[1,2-a]pyridine-6-carboxylic acid is sourced from PubChem (CID 62651900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).