C10H7FN2O2 — CID 82530339
(E)-3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid (PubChem CID 82530339) has the molecular formula C10H7FN2O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is (E)-3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid.
| Compound Name | (E)-3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 82530339 |
| Molecular Formula | C10H7FN2O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (E)-3-(6-fluoroimidazo[1,2-a]pyridin-3-yl)prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cnc2ccc(F)cn12 |
| InChI | InChI=1S/C10H7FN2O2/c11-7-1-3-9-12-5-8(13(9)6-7)2-4-10(14)15/h1-6H,(H,14,15)/b4-2+ |
| InChIKey | OLTXIVNKFKXSPQ-DUXPYHPUSA-N |
| XLogP | 1.57 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|