C9H7FN2O — CID 83874803
2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)acetaldehyde (PubChem CID 83874803) has the molecular formula C9H7FN2O and a molecular weight of 178.17 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)acetaldehyde.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)acetaldehyde |
|---|---|
| PubChem CID | 83874803 |
| Molecular Formula | C9H7FN2O |
| Molecular Weight | 178.17 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-3-yl)acetaldehyde |
| SMILES | O=CCc1cnc2ccc(F)cn12 |
| InChI | InChI=1S/C9H7FN2O/c10-7-1-2-9-11-5-8(3-4-13)12(9)6-7/h1-2,4-6H,3H2 |
| InChIKey | IPOZIHLXFSFSOH-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.17 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|