C14H11FN2S — CID 154706945
3-benzylsulfanyl-6-fluoroimidazo[1,2-a]pyridine (PubChem CID 154706945) has the molecular formula C14H11FN2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-benzylsulfanyl-6-fluoroimidazo[1,2-a]pyridine.
| Compound Name | 3-benzylsulfanyl-6-fluoroimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 154706945 |
| Molecular Formula | C14H11FN2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | 3-benzylsulfanyl-6-fluoroimidazo[1,2-a]pyridine |
| SMILES | Fc1ccc2ncc(SCc3ccccc3)n2c1 |
| InChI | InChI=1S/C14H11FN2S/c15-12-6-7-13-16-8-14(17(13)9-12)18-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | FBRAFOPGIRCLLW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |