C15H12FN3S — CID 82530283
2-benzyl-6-fluoroimidazo[1,2-a]pyridine-3-carbothioamide (PubChem CID 82530283) has the molecular formula C15H12FN3S and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-benzyl-6-fluoroimidazo[1,2-a]pyridine-3-carbothioamide.
| Compound Name | 2-benzyl-6-fluoroimidazo[1,2-a]pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 82530283 |
| Molecular Formula | C15H12FN3S |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-benzyl-6-fluoroimidazo[1,2-a]pyridine-3-carbothioamide |
| SMILES | NC(=S)c1c(Cc2ccccc2)nc2ccc(F)cn12 |
| InChI | InChI=1S/C15H12FN3S/c16-11-6-7-13-18-12(8-10-4-2-1-3-5-10)14(15(17)20)19(13)9-11/h1-7,9H,8H2,(H2,17,20) |
| InChIKey | WGKAEBPWVFQOSZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|