C8H8FN3 — CID 83873255
(6-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine (PubChem CID 83873255) has the molecular formula C8H8FN3 and a molecular weight of 165.17 g/mol. Its IUPAC name is (6-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine.
| Compound Name | (6-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine |
|---|---|
| PubChem CID | 83873255 |
| Molecular Formula | C8H8FN3 |
| Molecular Weight | 165.17 g/mol |
| Exact Mass | 165.07 |
| IUPAC Name | (6-fluoroimidazo[1,5-a]pyridin-3-yl)methanamine |
| SMILES | NCc1ncc2ccc(F)cn12 |
| InChI | InChI=1S/C8H8FN3/c9-6-1-2-7-4-11-8(3-10)12(7)5-6/h1-2,4-5H,3,10H2 |
| InChIKey | GDORPTPBFZOCEF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.17 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |