C11H15FN4 — CID 82058709
5-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pentan-1-amine (PubChem CID 82058709) has the molecular formula C11H15FN4 and a molecular weight of 222.27 g/mol. Its IUPAC name is 5-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pentan-1-amine.
| Compound Name | 5-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pentan-1-amine |
|---|---|
| PubChem CID | 82058709 |
| Molecular Formula | C11H15FN4 |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 5-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)pentan-1-amine |
| SMILES | NCCCCCc1nnc2ccc(F)cn12 |
| InChI | InChI=1S/C11H15FN4/c12-9-5-6-11-15-14-10(16(11)8-9)4-2-1-3-7-13/h5-6,8H,1-4,7,13H2 |
| InChIKey | NCAPALPHQTVNTE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|