C6H5FN4 — CID 105429663
6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 105429663) has the molecular formula C6H5FN4 and a molecular weight of 152.13 g/mol. Its IUPAC name is 6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
| Compound Name | 6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
|---|---|
| PubChem CID | 105429663 |
| Molecular Formula | C6H5FN4 |
| Molecular Weight | 152.13 g/mol |
| Exact Mass | 152.05 |
| IUPAC Name | 6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-amine |
| SMILES | Nc1nnc2ccc(F)cn12 |
| InChI | InChI=1S/C6H5FN4/c7-4-1-2-5-9-10-6(8)11(5)3-4/h1-3H,(H2,8,10) |
| InChIKey | YGFUBYQMIKHJDO-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.13 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |