About 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine
6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine (PubChem CID 590435) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
Analyze 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine?
The IUPAC name of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine (CID 590435) is 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine.
What is the SMILES notation for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine?
The canonical SMILES for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine is Cc1ccc2nnc(N)n2c1.
What is the InChIKey of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine?
The InChIKey is PKVCCRUNBRFZNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-2-3-6-9-10-7(8)11(6)4-5/h2-4H,1H3,(H2,8,10).
What are the key properties of 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine?
6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine has a molecular weight of 148.17 g/mol, XLogP of 0.62, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-[1,2,4]triazolo[4,3-a]pyridin-3-amine is sourced from PubChem (CID 590435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).