About ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate
ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (PubChem CID 118674755) has the molecular formula C10H11N3O2
and a molecular weight of 205.22 g/mol. Its IUPAC name is ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate.
Analyze ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The IUPAC name of ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate (CID 118674755) is ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate.
What is the SMILES notation for ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The canonical SMILES for ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate is CCOC(=O)c1nnc2ccc(C)cn12.
What is the InChIKey of ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
The InChIKey is GAJXCBXBEGLKDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3O2/c1-3-15-10(14)9-12-11-8-5-4-7(2)6-13(8)9/h4-6H,3H2,1-2H3.
What are the key properties of ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate?
ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate has a molecular weight of 205.22 g/mol, XLogP of 1.21, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-methyl-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylate is sourced from PubChem (CID 118674755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).