C12H15FN4 — CID 86687077
3-(azepan-1-yl)-6-fluoro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 86687077) has the molecular formula C12H15FN4 and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-(azepan-1-yl)-6-fluoro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(azepan-1-yl)-6-fluoro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 86687077 |
| Molecular Formula | C12H15FN4 |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 3-(azepan-1-yl)-6-fluoro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Fc1ccc2nnc(N3CCCCCC3)n2c1 |
| InChI | InChI=1S/C12H15FN4/c13-10-5-6-11-14-15-12(17(11)9-10)16-7-3-1-2-4-8-16/h5-6,9H,1-4,7-8H2 |
| InChIKey | GGAVFPKQYPKMMO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 33.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |