C16H23FN4O2 — CID 129299700
tert-butyl N-[4-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-N-methylcarbamate (PubChem CID 129299700) has the molecular formula C16H23FN4O2 and a molecular weight of 322.38 g/mol. Its IUPAC name is tert-butyl N-[4-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[4-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 129299700 |
| Molecular Formula | C16H23FN4O2 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | tert-butyl N-[4-(6-fluoro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)butyl]-N-methylcarbamate |
| SMILES | CN(CCCCc1nnc2ccc(F)cn12)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23FN4O2/c1-16(2,3)23-15(22)20(4)10-6-5-7-13-18-19-14-9-8-12(17)11-21(13)14/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | GZBUDEAYCBLFFR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|