C11H11ClN2O2S — CID 117139062
2-(6-chloroimidazo[1,5-a]pyridin-3-yl)thiolane 1,1-dioxide (PubChem CID 117139062) has the molecular formula C11H11ClN2O2S and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-(6-chloroimidazo[1,5-a]pyridin-3-yl)thiolane 1,1-dioxide.
| Compound Name | 2-(6-chloroimidazo[1,5-a]pyridin-3-yl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 117139062 |
| Molecular Formula | C11H11ClN2O2S |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 2-(6-chloroimidazo[1,5-a]pyridin-3-yl)thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCCC1c1ncc2ccc(Cl)cn12 |
| InChI | InChI=1S/C11H11ClN2O2S/c12-8-3-4-9-6-13-11(14(9)7-8)10-2-1-5-17(10,15)16/h3-4,6-7,10H,1-2,5H2 |
| InChIKey | PURAFFRNUADMBH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |