C14H19N3 — CID 117139154
6-methyl-3-(1-methylpiperidin-2-yl)imidazo[1,5-a]pyridine (PubChem CID 117139154) has the molecular formula C14H19N3 and a molecular weight of 229.33 g/mol. Its IUPAC name is 6-methyl-3-(1-methylpiperidin-2-yl)imidazo[1,5-a]pyridine.
| Compound Name | 6-methyl-3-(1-methylpiperidin-2-yl)imidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117139154 |
| Molecular Formula | C14H19N3 |
| Molecular Weight | 229.33 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 6-methyl-3-(1-methylpiperidin-2-yl)imidazo[1,5-a]pyridine |
| SMILES | Cc1ccc2cnc(C3CCCCN3C)n2c1 |
| InChI | InChI=1S/C14H19N3/c1-11-6-7-12-9-15-14(17(12)10-11)13-5-3-4-8-16(13)2/h6-7,9-10,13H,3-5,8H2,1-2H3 |
| InChIKey | JQLVMYXDYOLGFA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |