C12H8FN3O — CID 117139848
3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-ol (PubChem CID 117139848) has the molecular formula C12H8FN3O and a molecular weight of 229.21 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-ol.
| Compound Name | 3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-ol |
|---|---|
| PubChem CID | 117139848 |
| Molecular Formula | C12H8FN3O |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 3-(2-fluorophenyl)-[1,2,4]triazolo[4,3-a]pyridin-6-ol |
| SMILES | Oc1ccc2nnc(-c3ccccc3F)n2c1 |
| InChI | InChI=1S/C12H8FN3O/c13-10-4-2-1-3-9(10)12-15-14-11-6-5-8(17)7-16(11)12/h1-7,17H |
| InChIKey | CFGLCSZWFQNOFA-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |