C12H15N3 — CID 117142344
3-cyclopentyl-5-methyl-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117142344) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-cyclopentyl-5-methyl-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-cyclopentyl-5-methyl-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117142344 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-cyclopentyl-5-methyl-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | Cc1cccc2nnc(C3CCCC3)n12 |
| InChI | InChI=1S/C12H15N3/c1-9-5-4-8-11-13-14-12(15(9)11)10-6-2-3-7-10/h4-5,8,10H,2-3,6-7H2,1H3 |
| InChIKey | LALDLOWCNLYTGP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |