C13H17N3O — CID 117140658
3-cyclohexyl-5-methoxy-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117140658) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-cyclohexyl-5-methoxy-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-cyclohexyl-5-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117140658 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-cyclohexyl-5-methoxy-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | COc1cccc2nnc(C3CCCCC3)n12 |
| InChI | InChI=1S/C13H17N3O/c1-17-12-9-5-8-11-14-15-13(16(11)12)10-6-3-2-4-7-10/h5,8-10H,2-4,6-7H2,1H3 |
| InChIKey | AKJGATIJIDRIRW-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |