C12H15ClN4O — CID 117142388
4-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]morpholine (PubChem CID 117142388) has the molecular formula C12H15ClN4O and a molecular weight of 266.73 g/mol. Its IUPAC name is 4-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]morpholine.
| Compound Name | 4-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 117142388 |
| Molecular Formula | C12H15ClN4O |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-[2-(5-chloro-[1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]morpholine |
| SMILES | Clc1cccc2nnc(CCN3CCOCC3)n12 |
| InChI | InChI=1S/C12H15ClN4O/c13-10-2-1-3-11-14-15-12(17(10)11)4-5-16-6-8-18-9-7-16/h1-3H,4-9H2 |
| InChIKey | JNWWUTRKZVIYQJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|