C14H19N3O — CID 117142372
4-[2-(5-methylimidazo[1,5-a]pyridin-3-yl)ethyl]morpholine (PubChem CID 117142372) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-[2-(5-methylimidazo[1,5-a]pyridin-3-yl)ethyl]morpholine.
| Compound Name | 4-[2-(5-methylimidazo[1,5-a]pyridin-3-yl)ethyl]morpholine |
|---|---|
| PubChem CID | 117142372 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-[2-(5-methylimidazo[1,5-a]pyridin-3-yl)ethyl]morpholine |
| SMILES | Cc1cccc2cnc(CCN3CCOCC3)n12 |
| InChI | InChI=1S/C14H19N3O/c1-12-3-2-4-13-11-15-14(17(12)13)5-6-16-7-9-18-10-8-16/h2-4,11H,5-10H2,1H3 |
| InChIKey | JRUNKUFBICZUCQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 29.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |