C12H15N3 — CID 105453792
3-(azetidin-3-ylmethyl)-5-methylimidazo[1,5-a]pyridine (PubChem CID 105453792) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-(azetidin-3-ylmethyl)-5-methylimidazo[1,5-a]pyridine.
| Compound Name | 3-(azetidin-3-ylmethyl)-5-methylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 105453792 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-(azetidin-3-ylmethyl)-5-methylimidazo[1,5-a]pyridine |
| SMILES | Cc1cccc2cnc(CC3CNC3)n12 |
| InChI | InChI=1S/C12H15N3/c1-9-3-2-4-11-8-14-12(15(9)11)5-10-6-13-7-10/h2-4,8,10,13H,5-7H2,1H3 |
| InChIKey | LIWYUTPICNANSR-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |