C11H12FN3 — CID 105457237
3-(azetidin-3-ylmethyl)-5-fluoroimidazo[1,5-a]pyridine (PubChem CID 105457237) has the molecular formula C11H12FN3 and a molecular weight of 205.24 g/mol. Its IUPAC name is 3-(azetidin-3-ylmethyl)-5-fluoroimidazo[1,5-a]pyridine.
| Compound Name | 3-(azetidin-3-ylmethyl)-5-fluoroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 105457237 |
| Molecular Formula | C11H12FN3 |
| Molecular Weight | 205.24 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 3-(azetidin-3-ylmethyl)-5-fluoroimidazo[1,5-a]pyridine |
| SMILES | Fc1cccc2cnc(CC3CNC3)n12 |
| InChI | InChI=1S/C11H12FN3/c12-10-3-1-2-9-7-14-11(15(9)10)4-8-5-13-6-8/h1-3,7-8,13H,4-6H2 |
| InChIKey | SPWZJGLKDUVGRQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.24 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|