C12H15N3S — CID 117143199
[3-(thiolan-3-yl)imidazo[1,5-a]pyridin-7-yl]methanamine (PubChem CID 117143199) has the molecular formula C12H15N3S and a molecular weight of 233.34 g/mol. Its IUPAC name is [3-(thiolan-3-yl)imidazo[1,5-a]pyridin-7-yl]methanamine.
| Compound Name | [3-(thiolan-3-yl)imidazo[1,5-a]pyridin-7-yl]methanamine |
|---|---|
| PubChem CID | 117143199 |
| Molecular Formula | C12H15N3S |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | [3-(thiolan-3-yl)imidazo[1,5-a]pyridin-7-yl]methanamine |
| SMILES | NCc1ccn2c(C3CCSC3)ncc2c1 |
| InChI | InChI=1S/C12H15N3S/c13-6-9-1-3-15-11(5-9)7-14-12(15)10-2-4-16-8-10/h1,3,5,7,10H,2,4,6,8,13H2 |
| InChIKey | UHUPPVPKWYYGJW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |