C11H12N4O — CID 117143547
3-pyrrolidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde (PubChem CID 117143547) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is 3-pyrrolidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde.
| Compound Name | 3-pyrrolidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
|---|---|
| PubChem CID | 117143547 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-pyrrolidin-2-yl-[1,2,4]triazolo[4,3-a]pyridine-7-carbaldehyde |
| SMILES | O=Cc1ccn2c(C3CCCN3)nnc2c1 |
| InChI | InChI=1S/C11H12N4O/c16-7-8-3-5-15-10(6-8)13-14-11(15)9-2-1-4-12-9/h3,5-7,9,12H,1-2,4H2 |
| InChIKey | UBCUHNYDFUEGMU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|