C13H18N4 — CID 117144080
3-(1-ethylpyrrolidin-2-yl)imidazo[1,5-a]pyridin-7-amine (PubChem CID 117144080) has the molecular formula C13H18N4 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-(1-ethylpyrrolidin-2-yl)imidazo[1,5-a]pyridin-7-amine.
| Compound Name | 3-(1-ethylpyrrolidin-2-yl)imidazo[1,5-a]pyridin-7-amine |
|---|---|
| PubChem CID | 117144080 |
| Molecular Formula | C13H18N4 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 3-(1-ethylpyrrolidin-2-yl)imidazo[1,5-a]pyridin-7-amine |
| SMILES | CCN1CCCC1c1ncc2cc(N)ccn12 |
| InChI | InChI=1S/C13H18N4/c1-2-16-6-3-4-12(16)13-15-9-11-8-10(14)5-7-17(11)13/h5,7-9,12H,2-4,6,14H2,1H3 |
| InChIKey | YLAQXGNNZYMNJI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 46.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |