C11H7ClN2S — CID 117144365
7-chloro-3-thiophen-2-ylimidazo[1,5-a]pyridine (PubChem CID 117144365) has the molecular formula C11H7ClN2S and a molecular weight of 234.71 g/mol. Its IUPAC name is 7-chloro-3-thiophen-2-ylimidazo[1,5-a]pyridine.
| Compound Name | 7-chloro-3-thiophen-2-ylimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 117144365 |
| Molecular Formula | C11H7ClN2S |
| Molecular Weight | 234.71 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 7-chloro-3-thiophen-2-ylimidazo[1,5-a]pyridine |
| SMILES | Clc1ccn2c(-c3cccs3)ncc2c1 |
| InChI | InChI=1S/C11H7ClN2S/c12-8-3-4-14-9(6-8)7-13-11(14)10-2-1-5-15-10/h1-7H |
| InChIKey | GLLHPAYRXIQWGW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |