C8H7ClN2O — CID 105440332
(7-chloroimidazo[1,5-a]pyridin-3-yl)methanol (PubChem CID 105440332) has the molecular formula C8H7ClN2O and a molecular weight of 182.61 g/mol. Its IUPAC name is (7-chloroimidazo[1,5-a]pyridin-3-yl)methanol.
| Compound Name | (7-chloroimidazo[1,5-a]pyridin-3-yl)methanol |
|---|---|
| PubChem CID | 105440332 |
| Molecular Formula | C8H7ClN2O |
| Molecular Weight | 182.61 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | (7-chloroimidazo[1,5-a]pyridin-3-yl)methanol |
| SMILES | OCc1ncc2cc(Cl)ccn12 |
| InChI | InChI=1S/C8H7ClN2O/c9-6-1-2-11-7(3-6)4-10-8(11)5-12/h1-4,12H,5H2 |
| InChIKey | DSFCIQHVMGLLHE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.61 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |