About 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol
3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol (PubChem CID 117146330) has the molecular formula C12H14N2OS
and a molecular weight of 234.32 g/mol. Its IUPAC name is 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol.
Molecular Properties
| Compound Name | 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol |
| PubChem CID | 117146330 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol |
| SMILES | Oc1cccn2c(CC3CCSC3)ncc12 |
| InChI | InChI=1S/C12H14N2OS/c15-11-2-1-4-14-10(11)7-13-12(14)6-9-3-5-16-8-9/h1-2,4,7,9,15H,3,5-6,8H2 |
| InChIKey | IFRBCFXYVNNEFJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol?
The IUPAC name of 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol (CID 117146330) is 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol.
What is the SMILES notation for 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol?
The canonical SMILES for 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol is Oc1cccn2c(CC3CCSC3)ncc12.
What is the InChIKey of 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol?
The InChIKey is IFRBCFXYVNNEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS/c15-11-2-1-4-14-10(11)7-13-12(14)6-9-3-5-16-8-9/h1-2,4,7,9,15H,3,5-6,8H2.
What are the key properties of 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol?
3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol has a molecular weight of 234.32 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thiolan-3-ylmethyl)imidazo[1,5-a]pyridin-8-ol is sourced from PubChem (CID 117146330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).