C10H13N3O — CID 117254914
3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-8-ol (PubChem CID 117254914) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-8-ol.
| Compound Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-8-ol |
|---|---|
| PubChem CID | 117254914 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 3-[2-(methylamino)ethyl]imidazo[1,5-a]pyridin-8-ol |
| SMILES | CNCCc1ncc2c(O)cccn12 |
| InChI | InChI=1S/C10H13N3O/c1-11-5-4-10-12-7-8-9(14)3-2-6-13(8)10/h2-3,6-7,11,14H,4-5H2,1H3 |
| InChIKey | HFNSCPSVHOEDJX-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |