C43H74O7Si2 — CID 11714728
3-[(2S,4S,6S)-6-[(2S,5R,6S,7R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,7-dimethyloctyl]-2-phenyl-1,3-dioxan-4-yl]propan-1-ol (PubChem CID 11714728) has the molecular formula C43H74O7Si2 and a molecular weight of 759.23 g/mol. Its IUPAC name is 3-[(2S,4S,6S)-6-[(2S,5R,6S,7R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,7-dimethyloctyl]-2-phenyl-1,3-dioxan-4-yl]propan-1-ol.
| Compound Name | 3-[(2S,4S,6S)-6-[(2S,5R,6S,7R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,7-dimethyloctyl]-2-phenyl-1,3-dioxan-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 11714728 |
| Molecular Formula | C43H74O7Si2 |
| Molecular Weight | 759.23 g/mol |
| Exact Mass | 758.50 |
| IUPAC Name | 3-[(2S,4S,6S)-6-[(2S,5R,6S,7R)-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[(4-methoxyphenyl)methoxy]-5,7-dimethyloctyl]-2-phenyl-1,3-dioxan-4-yl]propan-1-ol |
| SMILES | COc1ccc(CO[C@@H]([C@H](C)CC[C@@H](C[C@@H]2C[C@H](CCCO)O[C@H](c3ccccc3)O2)O[Si](C)(C)C(C)(C)C)[C@H](C)CO[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C43H74O7Si2/c1-32(40(33(2)30-47-51(10,11)42(3,4)5)46-31-34-22-25-36(45-9)26-23-34)21-24-38(50-52(12,13)43(6,7)8)29-39-28-37(20-17-27-44)48-41(49-39)35-18-15-14-16-19-35/h14-16,18-19,22-23,25-26,32-33,37-41,44H,17,20-21,24,27-31H2,1-13H3/t32-,33-,37+,38+,39+,40+,41+/m1/s1 |
| InChIKey | SHZCYSKQGAUKNH-PQNFHGNCSA-N |
| XLogP | 11.08 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.23 |
| LogP ≤ 5 | 11.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|