C12H19N3OS — CID 117149498
[3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanol (PubChem CID 117149498) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is [3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanol.
| Compound Name | [3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanol |
|---|---|
| PubChem CID | 117149498 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [3-(thiolan-3-ylmethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-5-yl]methanol |
| SMILES | OCC1CCCc2nnc(CC3CCSC3)n21 |
| InChI | InChI=1S/C12H19N3OS/c16-7-10-2-1-3-11-13-14-12(15(10)11)6-9-4-5-17-8-9/h9-10,16H,1-8H2 |
| InChIKey | CJTHWXJKDMUYLT-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |