C13H15ClN4 — CID 117152949
3-[(2-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine (PubChem CID 117152949) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine.
| Compound Name | 3-[(2-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
|---|---|
| PubChem CID | 117152949 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-8-amine |
| SMILES | NC1CCCn2c(Cc3ccccc3Cl)nnc21 |
| InChI | InChI=1S/C13H15ClN4/c14-10-5-2-1-4-9(10)8-12-16-17-13-11(15)6-3-7-18(12)13/h1-2,4-5,11H,3,6-8,15H2 |
| InChIKey | SYFSXYRUOKMDNB-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |