C14H16FN3 — CID 117152945
3-[(2-fluorophenyl)methyl]-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 117152945) has the molecular formula C14H16FN3 and a molecular weight of 245.30 g/mol. Its IUPAC name is 3-[(2-fluorophenyl)methyl]-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-[(2-fluorophenyl)methyl]-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 117152945 |
| Molecular Formula | C14H16FN3 |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 3-[(2-fluorophenyl)methyl]-8-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC1CCCn2c(Cc3ccccc3F)nnc21 |
| InChI | InChI=1S/C14H16FN3/c1-10-5-4-8-18-13(16-17-14(10)18)9-11-6-2-3-7-12(11)15/h2-3,6-7,10H,4-5,8-9H2,1H3 |
| InChIKey | ZHPVHNSYLLZAES-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |