C16H17FN4O — CID 163312608
(1S,7S)-5-[(2-fluorophenyl)methyl]-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one (PubChem CID 163312608) has the molecular formula C16H17FN4O and a molecular weight of 300.34 g/mol. Its IUPAC name is (1S,7S)-5-[(2-fluorophenyl)methyl]-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one.
| Compound Name | (1S,7S)-5-[(2-fluorophenyl)methyl]-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
|---|---|
| PubChem CID | 163312608 |
| Molecular Formula | C16H17FN4O |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (1S,7S)-5-[(2-fluorophenyl)methyl]-7-methyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@H]2c2nnc(Cc3ccccc3F)n21 |
| InChI | InChI=1S/C16H17FN4O/c1-10-16(22)20-8-4-7-13(20)15-19-18-14(21(10)15)9-11-5-2-3-6-12(11)17/h2-3,5-6,10,13H,4,7-9H2,1H3/t10-,13-/m0/s1 |
| InChIKey | DTEPGARPWHRCJX-GWCFXTLKSA-N |
| XLogP | 2.25 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |