C15H16N4O — CID 163308414
(1R,7S)-7-methyl-5-phenyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one (PubChem CID 163308414) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is (1R,7S)-7-methyl-5-phenyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one.
| Compound Name | (1R,7S)-7-methyl-5-phenyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
|---|---|
| PubChem CID | 163308414 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1R,7S)-7-methyl-5-phenyl-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-2,4-dien-8-one |
| SMILES | C[C@H]1C(=O)N2CCC[C@@H]2c2nnc(-c3ccccc3)n21 |
| InChI | InChI=1S/C15H16N4O/c1-10-15(20)18-9-5-8-12(18)14-17-16-13(19(10)14)11-6-3-2-4-7-11/h2-4,6-7,10,12H,5,8-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | DUPFJJVYIUCTBU-CMPLNLGQSA-N |
| XLogP | 2.18 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |